C19H21ClIN3O — CID 38917765
N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-2-iodo-3-methylbenzamide (PubChem CID 38917765) has the molecular formula C19H21ClIN3O and a molecular weight of 469.75 g/mol. Its IUPAC name is N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-2-iodo-3-methylbenzamide.
| Compound Name | N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-2-iodo-3-methylbenzamide |
|---|---|
| PubChem CID | 38917765 |
| Molecular Formula | C19H21ClIN3O |
| Molecular Weight | 469.75 g/mol |
| Exact Mass | 469.04 |
| IUPAC Name | N-[5-chloro-2-(4-methylpiperazin-1-yl)phenyl]-2-iodo-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2cc(Cl)ccc2N2CCN(C)CC2)c1I |
| InChI | InChI=1S/C19H21ClIN3O/c1-13-4-3-5-15(18(13)21)19(25)22-16-12-14(20)6-7-17(16)24-10-8-23(2)9-11-24/h3-7,12H,8-11H2,1-2H3,(H,22,25) |
| InChIKey | FYVJZIPIXZBXJX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.75 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|