C19H20ClN3O3 — CID 46285198
3-[(2-chlorobenzoyl)amino]-4-(4-methylpiperazin-1-yl)benzoic acid (PubChem CID 46285198) has the molecular formula C19H20ClN3O3 and a molecular weight of 373.84 g/mol. Its IUPAC name is 3-[(2-chlorobenzoyl)amino]-4-(4-methylpiperazin-1-yl)benzoic acid.
| Compound Name | 3-[(2-chlorobenzoyl)amino]-4-(4-methylpiperazin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 46285198 |
| Molecular Formula | C19H20ClN3O3 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 3-[(2-chlorobenzoyl)amino]-4-(4-methylpiperazin-1-yl)benzoic acid |
| SMILES | CN1CCN(c2ccc(C(=O)O)cc2NC(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C19H20ClN3O3/c1-22-8-10-23(11-9-22)17-7-6-13(19(25)26)12-16(17)21-18(24)14-4-2-3-5-15(14)20/h2-7,12H,8-11H2,1H3,(H,21,24)(H,25,26) |
| InChIKey | KEPFMIZOMNTDGG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |