C12H11IN6O3 — CID 1219191
2-iodo-N-[1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]benzamide (PubChem CID 1219191) has the molecular formula C12H11IN6O3 and a molecular weight of 414.16 g/mol. Its IUPAC name is 2-iodo-N-[1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]benzamide.
| Compound Name | 2-iodo-N-[1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]benzamide |
|---|---|
| PubChem CID | 1219191 |
| Molecular Formula | C12H11IN6O3 |
| Molecular Weight | 414.16 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | 2-iodo-N-[1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]benzamide |
| SMILES | CC(Cn1cnc([N+](=O)[O-])n1)=NNC(=O)c1ccccc1I |
| InChI | InChI=1S/C12H11IN6O3/c1-8(6-18-7-14-12(17-18)19(21)22)15-16-11(20)9-4-2-3-5-10(9)13/h2-5,7H,6H2,1H3,(H,16,20) |
| InChIKey | WOXQGVMVYKAYNX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.16 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|