C12H12N6O3 — CID 7348324
2-(3-nitro-1,2,4-triazol-1-yl)-N-[(E)-2-phenylethylideneamino]acetamide (PubChem CID 7348324) has the molecular formula C12H12N6O3 and a molecular weight of 288.27 g/mol. Its IUPAC name is 2-(3-nitro-1,2,4-triazol-1-yl)-N-[(E)-2-phenylethylideneamino]acetamide.
| Compound Name | 2-(3-nitro-1,2,4-triazol-1-yl)-N-[(E)-2-phenylethylideneamino]acetamide |
|---|---|
| PubChem CID | 7348324 |
| Molecular Formula | C12H12N6O3 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2-(3-nitro-1,2,4-triazol-1-yl)-N-[(E)-2-phenylethylideneamino]acetamide |
| SMILES | O=C(Cn1cnc([N+](=O)[O-])n1)N/N=C/Cc1ccccc1 |
| InChI | InChI=1S/C12H12N6O3/c19-11(8-17-9-13-12(16-17)18(20)21)15-14-7-6-10-4-2-1-3-5-10/h1-5,7,9H,6,8H2,(H,15,19)/b14-7+ |
| InChIKey | PMDLCSJIUZYZQD-VGOFMYFVSA-N |
| XLogP | 0.53 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|