C19H14N6O3 — CID 7347003
N-[(E)-anthracen-9-ylmethylideneamino]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide (PubChem CID 7347003) has the molecular formula C19H14N6O3 and a molecular weight of 374.36 g/mol. Its IUPAC name is N-[(E)-anthracen-9-ylmethylideneamino]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-[(E)-anthracen-9-ylmethylideneamino]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 7347003 |
| Molecular Formula | C19H14N6O3 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | N-[(E)-anthracen-9-ylmethylideneamino]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
| SMILES | O=C(Cn1cnc([N+](=O)[O-])n1)N/N=C/c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C19H14N6O3/c26-18(11-24-12-20-19(23-24)25(27)28)22-21-10-17-15-7-3-1-5-13(15)9-14-6-2-4-8-16(14)17/h1-10,12H,11H2,(H,22,26)/b21-10+ |
| InChIKey | ZYRLRCJTGXCZCK-UFFVCSGVSA-N |
| XLogP | 2.64 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|