C20H16N6O3 — CID 3258143
N-(anthracen-9-ylmethylideneamino)-N-methyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide (PubChem CID 3258143) has the molecular formula C20H16N6O3 and a molecular weight of 388.39 g/mol. Its IUPAC name is N-(anthracen-9-ylmethylideneamino)-N-methyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-(anthracen-9-ylmethylideneamino)-N-methyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 3258143 |
| Molecular Formula | C20H16N6O3 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | N-(anthracen-9-ylmethylideneamino)-N-methyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
| SMILES | CN(N=Cc1c2ccccc2cc2ccccc12)C(=O)Cn1cnc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C20H16N6O3/c1-24(19(27)12-25-13-21-20(23-25)26(28)29)22-11-18-16-8-4-2-6-14(16)10-15-7-3-5-9-17(15)18/h2-11,13H,12H2,1H3 |
| InChIKey | UMYQPYYSUPNVSK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 106.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|