C15H18N6O6 — CID 23934107
N-methyl-2-(3-nitro-1,2,4-triazol-1-yl)-N-[(3,4,5-trimethoxyphenyl)methylideneamino]acetamide (PubChem CID 23934107) has the molecular formula C15H18N6O6 and a molecular weight of 378.35 g/mol. Its IUPAC name is N-methyl-2-(3-nitro-1,2,4-triazol-1-yl)-N-[(3,4,5-trimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | N-methyl-2-(3-nitro-1,2,4-triazol-1-yl)-N-[(3,4,5-trimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 23934107 |
| Molecular Formula | C15H18N6O6 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | N-methyl-2-(3-nitro-1,2,4-triazol-1-yl)-N-[(3,4,5-trimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cc(C=NN(C)C(=O)Cn2cnc([N+](=O)[O-])n2)cc(OC)c1OC |
| InChI | InChI=1S/C15H18N6O6/c1-19(13(22)8-20-9-16-15(18-20)21(23)24)17-7-10-5-11(25-2)14(27-4)12(6-10)26-3/h5-7,9H,8H2,1-4H3 |
| InChIKey | XIRJMJWAQJSMJN-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 134.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|