C8H10N4O5 — CID 60974661
ethyl 4-(3-nitro-1,2,4-triazol-1-yl)-3-oxobutanoate (PubChem CID 60974661) has the molecular formula C8H10N4O5 and a molecular weight of 242.19 g/mol. Its IUPAC name is ethyl 4-(3-nitro-1,2,4-triazol-1-yl)-3-oxobutanoate.
| Compound Name | ethyl 4-(3-nitro-1,2,4-triazol-1-yl)-3-oxobutanoate |
|---|---|
| PubChem CID | 60974661 |
| Molecular Formula | C8H10N4O5 |
| Molecular Weight | 242.19 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | ethyl 4-(3-nitro-1,2,4-triazol-1-yl)-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)Cn1cnc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C8H10N4O5/c1-2-17-7(14)3-6(13)4-11-5-9-8(10-11)12(15)16/h5H,2-4H2,1H3 |
| InChIKey | MEUGWXBSIBIENV-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 117.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.19 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|