C5H8N4O3 — CID 7335543
(2S)-1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 7335543) has the molecular formula C5H8N4O3 and a molecular weight of 172.14 g/mol. Its IUPAC name is (2S)-1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | (2S)-1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 7335543 |
| Molecular Formula | C5H8N4O3 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | (2S)-1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | C[C@H](O)Cn1cnc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C5H8N4O3/c1-4(10)2-8-3-6-5(7-8)9(11)12/h3-4,10H,2H2,1H3/t4-/m0/s1 |
| InChIKey | XODOKJWNDVFKPH-BYPYZUCNSA-N |
| XLogP | -0.43 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|