About 1-(3-nitro-1,2,4-triazol-1-yl)butan-2-ol
1-(3-nitro-1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 60912463) has the molecular formula C6H10N4O3
and a molecular weight of 186.17 g/mol. Its IUPAC name is 1-(3-nitro-1,2,4-triazol-1-yl)butan-2-ol.
Molecular Properties
| Compound Name | 1-(3-nitro-1,2,4-triazol-1-yl)butan-2-ol |
| PubChem CID | 60912463 |
| Molecular Formula | C6H10N4O3 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 1-(3-nitro-1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | CCC(O)Cn1cnc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C6H10N4O3/c1-2-5(11)3-9-4-7-6(8-9)10(12)13/h4-5,11H,2-3H2,1H3 |
| InChIKey | RULQMHXPKAMMLF-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-nitro-1,2,4-triazol-1-yl)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-nitro-1,2,4-triazol-1-yl)butan-2-ol?
The IUPAC name of 1-(3-nitro-1,2,4-triazol-1-yl)butan-2-ol (CID 60912463) is 1-(3-nitro-1,2,4-triazol-1-yl)butan-2-ol.
What is the SMILES notation for 1-(3-nitro-1,2,4-triazol-1-yl)butan-2-ol?
The canonical SMILES for 1-(3-nitro-1,2,4-triazol-1-yl)butan-2-ol is CCC(O)Cn1cnc([N+](=O)[O-])n1.
What is the InChIKey of 1-(3-nitro-1,2,4-triazol-1-yl)butan-2-ol?
The InChIKey is RULQMHXPKAMMLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O3/c1-2-5(11)3-9-4-7-6(8-9)10(12)13/h4-5,11H,2-3H2,1H3.
What are the key properties of 1-(3-nitro-1,2,4-triazol-1-yl)butan-2-ol?
1-(3-nitro-1,2,4-triazol-1-yl)butan-2-ol has a molecular weight of 186.17 g/mol, XLogP of -0.04, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-nitro-1,2,4-triazol-1-yl)butan-2-ol is sourced from PubChem (CID 60912463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).