C7H9F2N5O3 — CID 15077073
N-ethyl-2,2-difluoro-3-(3-nitro-1,2,4-triazol-1-yl)propanamide (PubChem CID 15077073) has the molecular formula C7H9F2N5O3 and a molecular weight of 249.18 g/mol. Its IUPAC name is N-ethyl-2,2-difluoro-3-(3-nitro-1,2,4-triazol-1-yl)propanamide.
| Compound Name | N-ethyl-2,2-difluoro-3-(3-nitro-1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 15077073 |
| Molecular Formula | C7H9F2N5O3 |
| Molecular Weight | 249.18 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | N-ethyl-2,2-difluoro-3-(3-nitro-1,2,4-triazol-1-yl)propanamide |
| SMILES | CCNC(=O)C(F)(F)Cn1cnc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C7H9F2N5O3/c1-2-10-5(15)7(8,9)3-13-4-11-6(12-13)14(16)17/h4H,2-3H2,1H3,(H,10,15) |
| InChIKey | GCNSLYPAMZLTKZ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.18 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|