C7H11N5O3S — CID 23274405
N-(2-methylsulfanylethyl)-2-(3-nitro-1,2,4-triazol-1-yl)acetamide (PubChem CID 23274405) has the molecular formula C7H11N5O3S and a molecular weight of 245.26 g/mol. Its IUPAC name is N-(2-methylsulfanylethyl)-2-(3-nitro-1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-(2-methylsulfanylethyl)-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 23274405 |
| Molecular Formula | C7H11N5O3S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | N-(2-methylsulfanylethyl)-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
| SMILES | CSCCNC(=O)Cn1cnc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C7H11N5O3S/c1-16-3-2-8-6(13)4-11-5-9-7(10-11)12(14)15/h5H,2-4H2,1H3,(H,8,13) |
| InChIKey | FURILSQYZNOETQ-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|