C11H9ClN6O4 — CID 60519361
2-chloro-N'-[2-(3-nitro-1,2,4-triazol-1-yl)acetyl]benzohydrazide (PubChem CID 60519361) has the molecular formula C11H9ClN6O4 and a molecular weight of 324.68 g/mol. Its IUPAC name is 2-chloro-N'-[2-(3-nitro-1,2,4-triazol-1-yl)acetyl]benzohydrazide.
| Compound Name | 2-chloro-N'-[2-(3-nitro-1,2,4-triazol-1-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 60519361 |
| Molecular Formula | C11H9ClN6O4 |
| Molecular Weight | 324.68 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 2-chloro-N'-[2-(3-nitro-1,2,4-triazol-1-yl)acetyl]benzohydrazide |
| SMILES | O=C(Cn1cnc([N+](=O)[O-])n1)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C11H9ClN6O4/c12-8-4-2-1-3-7(8)10(20)15-14-9(19)5-17-6-13-11(16-17)18(21)22/h1-4,6H,5H2,(H,14,19)(H,15,20) |
| InChIKey | HXNVMYIUAAQWMZ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.68 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|