C15H17ClN6O4 — CID 87045223
2-chloro-N,N-diethyl-4-[[2-(3-nitro-1,2,4-triazol-1-yl)acetyl]amino]benzamide (PubChem CID 87045223) has the molecular formula C15H17ClN6O4 and a molecular weight of 380.79 g/mol. Its IUPAC name is 2-chloro-N,N-diethyl-4-[[2-(3-nitro-1,2,4-triazol-1-yl)acetyl]amino]benzamide.
| Compound Name | 2-chloro-N,N-diethyl-4-[[2-(3-nitro-1,2,4-triazol-1-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 87045223 |
| Molecular Formula | C15H17ClN6O4 |
| Molecular Weight | 380.79 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 2-chloro-N,N-diethyl-4-[[2-(3-nitro-1,2,4-triazol-1-yl)acetyl]amino]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)Cn2cnc([N+](=O)[O-])n2)cc1Cl |
| InChI | InChI=1S/C15H17ClN6O4/c1-3-20(4-2)14(24)11-6-5-10(7-12(11)16)18-13(23)8-21-9-17-15(19-21)22(25)26/h5-7,9H,3-4,8H2,1-2H3,(H,18,23) |
| InChIKey | WEEXOSSLCWACBS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 123.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.79 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|