C19H22ClN3O2 — CID 119712519
4-[[2-(4-aminophenyl)acetyl]amino]-2-chloro-N,N-diethylbenzamide (PubChem CID 119712519) has the molecular formula C19H22ClN3O2 and a molecular weight of 359.86 g/mol. Its IUPAC name is 4-[[2-(4-aminophenyl)acetyl]amino]-2-chloro-N,N-diethylbenzamide.
| Compound Name | 4-[[2-(4-aminophenyl)acetyl]amino]-2-chloro-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 119712519 |
| Molecular Formula | C19H22ClN3O2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 4-[[2-(4-aminophenyl)acetyl]amino]-2-chloro-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)Cc2ccc(N)cc2)cc1Cl |
| InChI | InChI=1S/C19H22ClN3O2/c1-3-23(4-2)19(25)16-10-9-15(12-17(16)20)22-18(24)11-13-5-7-14(21)8-6-13/h5-10,12H,3-4,11,21H2,1-2H3,(H,22,24) |
| InChIKey | LAHBOTCUQYCJND-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|