C20H22ClFN2O2 — CID 34745595
2-chloro-N,N-diethyl-4-[3-(2-fluorophenyl)propanoylamino]benzamide (PubChem CID 34745595) has the molecular formula C20H22ClFN2O2 and a molecular weight of 376.86 g/mol. Its IUPAC name is 2-chloro-N,N-diethyl-4-[3-(2-fluorophenyl)propanoylamino]benzamide.
| Compound Name | 2-chloro-N,N-diethyl-4-[3-(2-fluorophenyl)propanoylamino]benzamide |
|---|---|
| PubChem CID | 34745595 |
| Molecular Formula | C20H22ClFN2O2 |
| Molecular Weight | 376.86 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2-chloro-N,N-diethyl-4-[3-(2-fluorophenyl)propanoylamino]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)CCc2ccccc2F)cc1Cl |
| InChI | InChI=1S/C20H22ClFN2O2/c1-3-24(4-2)20(26)16-11-10-15(13-17(16)21)23-19(25)12-9-14-7-5-6-8-18(14)22/h5-8,10-11,13H,3-4,9,12H2,1-2H3,(H,23,25) |
| InChIKey | XJDLGNMNHBBWMY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.86 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |