C20H20ClFN2O2 — CID 55673169
2-chloro-N,N-diethyl-4-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]benzamide (PubChem CID 55673169) has the molecular formula C20H20ClFN2O2 and a molecular weight of 374.84 g/mol. Its IUPAC name is 2-chloro-N,N-diethyl-4-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]benzamide.
| Compound Name | 2-chloro-N,N-diethyl-4-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 55673169 |
| Molecular Formula | C20H20ClFN2O2 |
| Molecular Weight | 374.84 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 2-chloro-N,N-diethyl-4-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)/C=C/c2ccccc2F)cc1Cl |
| InChI | InChI=1S/C20H20ClFN2O2/c1-3-24(4-2)20(26)16-11-10-15(13-17(16)21)23-19(25)12-9-14-7-5-6-8-18(14)22/h5-13H,3-4H2,1-2H3,(H,23,25)/b12-9+ |
| InChIKey | QQAGDBGFBUTHIJ-FMIVXFBMSA-N |
| XLogP | 4.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.84 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|