C19H17Cl3N2O3 — CID 55877500
2-chloro-4-[[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]-N-(2-methoxyethyl)benzamide (PubChem CID 55877500) has the molecular formula C19H17Cl3N2O3 and a molecular weight of 427.72 g/mol. Its IUPAC name is 2-chloro-4-[[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]-N-(2-methoxyethyl)benzamide.
| Compound Name | 2-chloro-4-[[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 55877500 |
| Molecular Formula | C19H17Cl3N2O3 |
| Molecular Weight | 427.72 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 2-chloro-4-[[(E)-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccc(NC(=O)/C=C/c2cccc(Cl)c2Cl)cc1Cl |
| InChI | InChI=1S/C19H17Cl3N2O3/c1-27-10-9-23-19(26)14-7-6-13(11-16(14)21)24-17(25)8-5-12-3-2-4-15(20)18(12)22/h2-8,11H,9-10H2,1H3,(H,23,26)(H,24,25)/b8-5+ |
| InChIKey | NSJAYGWQFPHUKL-VMPITWQZSA-N |
| XLogP | 4.67 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.72 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|