C19H18Cl2N2O2 — CID 60576616
2-chloro-4-[[(E)-3-(3-chlorophenyl)prop-2-enoyl]amino]-N-propylbenzamide (PubChem CID 60576616) has the molecular formula C19H18Cl2N2O2 and a molecular weight of 377.27 g/mol. Its IUPAC name is 2-chloro-4-[[(E)-3-(3-chlorophenyl)prop-2-enoyl]amino]-N-propylbenzamide.
| Compound Name | 2-chloro-4-[[(E)-3-(3-chlorophenyl)prop-2-enoyl]amino]-N-propylbenzamide |
|---|---|
| PubChem CID | 60576616 |
| Molecular Formula | C19H18Cl2N2O2 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 2-chloro-4-[[(E)-3-(3-chlorophenyl)prop-2-enoyl]amino]-N-propylbenzamide |
| SMILES | CCCNC(=O)c1ccc(NC(=O)/C=C/c2cccc(Cl)c2)cc1Cl |
| InChI | InChI=1S/C19H18Cl2N2O2/c1-2-10-22-19(25)16-8-7-15(12-17(16)21)23-18(24)9-6-13-4-3-5-14(20)11-13/h3-9,11-12H,2,10H2,1H3,(H,22,25)(H,23,24)/b9-6+ |
| InChIKey | XQZBATUNGNXLHO-RMKNXTFCSA-N |
| XLogP | 4.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|