C17H13Cl3N2O2 — CID 75842438
N-(5-acetamido-2-chlorophenyl)-3-(2,3-dichlorophenyl)prop-2-enamide (PubChem CID 75842438) has the molecular formula C17H13Cl3N2O2 and a molecular weight of 383.66 g/mol. Its IUPAC name is N-(5-acetamido-2-chlorophenyl)-3-(2,3-dichlorophenyl)prop-2-enamide.
| Compound Name | N-(5-acetamido-2-chlorophenyl)-3-(2,3-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 75842438 |
| Molecular Formula | C17H13Cl3N2O2 |
| Molecular Weight | 383.66 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | N-(5-acetamido-2-chlorophenyl)-3-(2,3-dichlorophenyl)prop-2-enamide |
| SMILES | CC(=O)Nc1ccc(Cl)c(NC(=O)C=Cc2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C17H13Cl3N2O2/c1-10(23)21-12-6-7-13(18)15(9-12)22-16(24)8-5-11-3-2-4-14(19)17(11)20/h2-9H,1H3,(H,21,23)(H,22,24) |
| InChIKey | CDGZEJKRPSCTTQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.66 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|