C20H20BrFN2O2 — CID 8503764
4-[[(E)-3-(5-bromo-2-fluorophenyl)prop-2-enoyl]amino]-N,N-diethylbenzamide (PubChem CID 8503764) has the molecular formula C20H20BrFN2O2 and a molecular weight of 419.29 g/mol. Its IUPAC name is 4-[[(E)-3-(5-bromo-2-fluorophenyl)prop-2-enoyl]amino]-N,N-diethylbenzamide.
| Compound Name | 4-[[(E)-3-(5-bromo-2-fluorophenyl)prop-2-enoyl]amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 8503764 |
| Molecular Formula | C20H20BrFN2O2 |
| Molecular Weight | 419.29 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 4-[[(E)-3-(5-bromo-2-fluorophenyl)prop-2-enoyl]amino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)/C=C/c2cc(Br)ccc2F)cc1 |
| InChI | InChI=1S/C20H20BrFN2O2/c1-3-24(4-2)20(26)14-5-9-17(10-6-14)23-19(25)12-7-15-13-16(21)8-11-18(15)22/h5-13H,3-4H2,1-2H3,(H,23,25)/b12-7+ |
| InChIKey | PGINRSAPIOYCAH-KPKJPENVSA-N |
| XLogP | 4.72 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.29 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|