C23H28ClN3O2 — CID 51135599
2-chloro-N,N-diethyl-4-[(2-phenyl-2-pyrrolidin-1-ylacetyl)amino]benzamide (PubChem CID 51135599) has the molecular formula C23H28ClN3O2 and a molecular weight of 413.95 g/mol. Its IUPAC name is 2-chloro-N,N-diethyl-4-[(2-phenyl-2-pyrrolidin-1-ylacetyl)amino]benzamide.
| Compound Name | 2-chloro-N,N-diethyl-4-[(2-phenyl-2-pyrrolidin-1-ylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 51135599 |
| Molecular Formula | C23H28ClN3O2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 2-chloro-N,N-diethyl-4-[(2-phenyl-2-pyrrolidin-1-ylacetyl)amino]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)C(c2ccccc2)N2CCCC2)cc1Cl |
| InChI | InChI=1S/C23H28ClN3O2/c1-3-26(4-2)23(29)19-13-12-18(16-20(19)24)25-22(28)21(27-14-8-9-15-27)17-10-6-5-7-11-17/h5-7,10-13,16,21H,3-4,8-9,14-15H2,1-2H3,(H,25,28) |
| InChIKey | APSIEDJEPMCQDZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |