C19H20Cl2N2O — CID 2563626
(2S)-N-(3,5-dichlorophenyl)-2-phenyl-2-piperidin-1-ylacetamide (PubChem CID 2563626) has the molecular formula C19H20Cl2N2O and a molecular weight of 363.29 g/mol. Its IUPAC name is (2S)-N-(3,5-dichlorophenyl)-2-phenyl-2-piperidin-1-ylacetamide.
| Compound Name | (2S)-N-(3,5-dichlorophenyl)-2-phenyl-2-piperidin-1-ylacetamide |
|---|---|
| PubChem CID | 2563626 |
| Molecular Formula | C19H20Cl2N2O |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | (2S)-N-(3,5-dichlorophenyl)-2-phenyl-2-piperidin-1-ylacetamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)[C@H](c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C19H20Cl2N2O/c20-15-11-16(21)13-17(12-15)22-19(24)18(14-7-3-1-4-8-14)23-9-5-2-6-10-23/h1,3-4,7-8,11-13,18H,2,5-6,9-10H2,(H,22,24)/t18-/m0/s1 |
| InChIKey | AJXKDMVUTLCKPR-SFHVURJKSA-N |
| XLogP | 5.16 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |