C18H18ClIN2O — CID 56556713
N-(2-chloro-4-iodophenyl)-2-phenyl-2-pyrrolidin-1-ylacetamide (PubChem CID 56556713) has the molecular formula C18H18ClIN2O and a molecular weight of 440.71 g/mol. Its IUPAC name is N-(2-chloro-4-iodophenyl)-2-phenyl-2-pyrrolidin-1-ylacetamide.
| Compound Name | N-(2-chloro-4-iodophenyl)-2-phenyl-2-pyrrolidin-1-ylacetamide |
|---|---|
| PubChem CID | 56556713 |
| Molecular Formula | C18H18ClIN2O |
| Molecular Weight | 440.71 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | N-(2-chloro-4-iodophenyl)-2-phenyl-2-pyrrolidin-1-ylacetamide |
| SMILES | O=C(Nc1ccc(I)cc1Cl)C(c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C18H18ClIN2O/c19-15-12-14(20)8-9-16(15)21-18(23)17(22-10-4-5-11-22)13-6-2-1-3-7-13/h1-3,6-9,12,17H,4-5,10-11H2,(H,21,23) |
| InChIKey | ZFUXSLWUUKPKFX-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.71 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|