C19H19ClIN3O2 — CID 112825618
4-benzoyl-N-(2-chloro-4-iodophenyl)-1,4-diazepane-1-carboxamide (PubChem CID 112825618) has the molecular formula C19H19ClIN3O2 and a molecular weight of 483.74 g/mol. Its IUPAC name is 4-benzoyl-N-(2-chloro-4-iodophenyl)-1,4-diazepane-1-carboxamide.
| Compound Name | 4-benzoyl-N-(2-chloro-4-iodophenyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 112825618 |
| Molecular Formula | C19H19ClIN3O2 |
| Molecular Weight | 483.74 g/mol |
| Exact Mass | 483.02 |
| IUPAC Name | 4-benzoyl-N-(2-chloro-4-iodophenyl)-1,4-diazepane-1-carboxamide |
| SMILES | O=C(Nc1ccc(I)cc1Cl)N1CCCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C19H19ClIN3O2/c20-16-13-15(21)7-8-17(16)22-19(26)24-10-4-9-23(11-12-24)18(25)14-5-2-1-3-6-14/h1-3,5-8,13H,4,9-12H2,(H,22,26) |
| InChIKey | DOZNCCSMJSKTKV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.74 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|