C19H20ClN3O2 — CID 110811610
4-(2-chlorobenzoyl)-N-phenyl-1,4-diazepane-1-carboxamide (PubChem CID 110811610) has the molecular formula C19H20ClN3O2 and a molecular weight of 357.84 g/mol. Its IUPAC name is 4-(2-chlorobenzoyl)-N-phenyl-1,4-diazepane-1-carboxamide.
| Compound Name | 4-(2-chlorobenzoyl)-N-phenyl-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 110811610 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 4-(2-chlorobenzoyl)-N-phenyl-1,4-diazepane-1-carboxamide |
| SMILES | O=C(Nc1ccccc1)N1CCCN(C(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C19H20ClN3O2/c20-17-10-5-4-9-16(17)18(24)22-11-6-12-23(14-13-22)19(25)21-15-7-2-1-3-8-15/h1-5,7-10H,6,11-14H2,(H,21,25) |
| InChIKey | KUSVNTPSGVLDBO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |