C19H25ClN2O4 — CID 120672558
4-[[3-chloro-4-(diethylcarbamoyl)phenyl]carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 120672558) has the molecular formula C19H25ClN2O4 and a molecular weight of 380.87 g/mol. Its IUPAC name is 4-[[3-chloro-4-(diethylcarbamoyl)phenyl]carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[3-chloro-4-(diethylcarbamoyl)phenyl]carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120672558 |
| Molecular Formula | C19H25ClN2O4 |
| Molecular Weight | 380.87 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 4-[[3-chloro-4-(diethylcarbamoyl)phenyl]carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)C2CCC(C(=O)O)CC2)cc1Cl |
| InChI | InChI=1S/C19H25ClN2O4/c1-3-22(4-2)18(24)15-10-9-14(11-16(15)20)21-17(23)12-5-7-13(8-6-12)19(25)26/h9-13H,3-8H2,1-2H3,(H,21,23)(H,25,26) |
| InChIKey | LKUYXIGAWDEVQD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.87 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |