C12H12ClN5O4 — CID 87046523
N-(3-chloro-4-ethoxyphenyl)-2-(3-nitro-1,2,4-triazol-1-yl)acetamide (PubChem CID 87046523) has the molecular formula C12H12ClN5O4 and a molecular weight of 325.71 g/mol. Its IUPAC name is N-(3-chloro-4-ethoxyphenyl)-2-(3-nitro-1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-(3-chloro-4-ethoxyphenyl)-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 87046523 |
| Molecular Formula | C12H12ClN5O4 |
| Molecular Weight | 325.71 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | N-(3-chloro-4-ethoxyphenyl)-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
| SMILES | CCOc1ccc(NC(=O)Cn2cnc([N+](=O)[O-])n2)cc1Cl |
| InChI | InChI=1S/C12H12ClN5O4/c1-2-22-10-4-3-8(5-9(10)13)15-11(19)6-17-7-14-12(16-17)18(20)21/h3-5,7H,2,6H2,1H3,(H,15,19) |
| InChIKey | SOAYPDIATDYBGD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.71 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|