C11H11N7O3 — CID 4654455
N'-[3-(3-nitro-1,2,4-triazol-1-yl)prop-1-en-2-yl]pyridine-3-carbohydrazide (PubChem CID 4654455) has the molecular formula C11H11N7O3 and a molecular weight of 289.25 g/mol. Its IUPAC name is N'-[3-(3-nitro-1,2,4-triazol-1-yl)prop-1-en-2-yl]pyridine-3-carbohydrazide.
| Compound Name | N'-[3-(3-nitro-1,2,4-triazol-1-yl)prop-1-en-2-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 4654455 |
| Molecular Formula | C11H11N7O3 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N'-[3-(3-nitro-1,2,4-triazol-1-yl)prop-1-en-2-yl]pyridine-3-carbohydrazide |
| SMILES | C=C(Cn1cnc([N+](=O)[O-])n1)NNC(=O)c1cccnc1 |
| InChI | InChI=1S/C11H11N7O3/c1-8(6-17-7-13-11(16-17)18(20)21)14-15-10(19)9-3-2-4-12-5-9/h2-5,7,14H,1,6H2,(H,15,19) |
| InChIKey | LNRKPTQQOBAAIM-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|