C13H14N6O4 — CID 29435870
N'-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]pyridine-3-carbohydrazide (PubChem CID 29435870) has the molecular formula C13H14N6O4 and a molecular weight of 318.29 g/mol. Its IUPAC name is N'-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]pyridine-3-carbohydrazide.
| Compound Name | N'-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 29435870 |
| Molecular Formula | C13H14N6O4 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | N'-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]pyridine-3-carbohydrazide |
| SMILES | Cc1nn(CC(=O)NNC(=O)c2cccnc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14N6O4/c1-8-12(19(22)23)9(2)18(17-8)7-11(20)15-16-13(21)10-4-3-5-14-6-10/h3-6H,7H2,1-2H3,(H,15,20)(H,16,21) |
| InChIKey | XAYYPBGDBJEVTI-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|