C23H19ClN6O4 — CID 24540302
2-(4-chlorophenyl)-N'-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]quinoline-4-carbohydrazide (PubChem CID 24540302) has the molecular formula C23H19ClN6O4 and a molecular weight of 478.90 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N'-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]quinoline-4-carbohydrazide.
| Compound Name | 2-(4-chlorophenyl)-N'-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]quinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 24540302 |
| Molecular Formula | C23H19ClN6O4 |
| Molecular Weight | 478.90 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 2-(4-chlorophenyl)-N'-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]quinoline-4-carbohydrazide |
| SMILES | Cc1nn(CC(=O)NNC(=O)c2cc(-c3ccc(Cl)cc3)nc3ccccc23)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C23H19ClN6O4/c1-13-22(30(33)34)14(2)29(28-13)12-21(31)26-27-23(32)18-11-20(15-7-9-16(24)10-8-15)25-19-6-4-3-5-17(18)19/h3-11H,12H2,1-2H3,(H,26,31)(H,27,32) |
| InChIKey | LJMLNKOOADRJLR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.90 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|