C10H14N6O4 — CID 5303534
1-[2-(3-nitro-1,2,4-triazol-1-yl)acetyl]piperidine-4-carboxamide (PubChem CID 5303534) has the molecular formula C10H14N6O4 and a molecular weight of 282.26 g/mol. Its IUPAC name is 1-[2-(3-nitro-1,2,4-triazol-1-yl)acetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(3-nitro-1,2,4-triazol-1-yl)acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 5303534 |
| Molecular Formula | C10H14N6O4 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 1-[2-(3-nitro-1,2,4-triazol-1-yl)acetyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)Cn2cnc([N+](=O)[O-])n2)CC1 |
| InChI | InChI=1S/C10H14N6O4/c11-9(18)7-1-3-14(4-2-7)8(17)5-15-6-12-10(13-15)16(19)20/h6-7H,1-5H2,(H2,11,18) |
| InChIKey | DEOQNPHMOHHNBO-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 137.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|