C11H18N6O2 — CID 115458891
1-[2-[4-(aminomethyl)triazol-1-yl]acetyl]piperidine-4-carboxamide (PubChem CID 115458891) has the molecular formula C11H18N6O2 and a molecular weight of 266.31 g/mol. Its IUPAC name is 1-[2-[4-(aminomethyl)triazol-1-yl]acetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[4-(aminomethyl)triazol-1-yl]acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 115458891 |
| Molecular Formula | C11H18N6O2 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1-[2-[4-(aminomethyl)triazol-1-yl]acetyl]piperidine-4-carboxamide |
| SMILES | NCc1cn(CC(=O)N2CCC(C(N)=O)CC2)nn1 |
| InChI | InChI=1S/C11H18N6O2/c12-5-9-6-17(15-14-9)7-10(18)16-3-1-8(2-4-16)11(13)19/h6,8H,1-5,7,12H2,(H2,13,19) |
| InChIKey | AVHOWSNUHOTKTR-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |