C12H19N5O4 — CID 115459912
2-[1-[2-[4-(aminomethyl)triazol-1-yl]acetyl]piperidin-4-yl]oxyacetic acid (PubChem CID 115459912) has the molecular formula C12H19N5O4 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-[1-[2-[4-(aminomethyl)triazol-1-yl]acetyl]piperidin-4-yl]oxyacetic acid.
| Compound Name | 2-[1-[2-[4-(aminomethyl)triazol-1-yl]acetyl]piperidin-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 115459912 |
| Molecular Formula | C12H19N5O4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2-[1-[2-[4-(aminomethyl)triazol-1-yl]acetyl]piperidin-4-yl]oxyacetic acid |
| SMILES | NCc1cn(CC(=O)N2CCC(OCC(=O)O)CC2)nn1 |
| InChI | InChI=1S/C12H19N5O4/c13-5-9-6-17(15-14-9)7-11(18)16-3-1-10(2-4-16)21-8-12(19)20/h6,10H,1-5,7-8,13H2,(H,19,20) |
| InChIKey | UVIJZEIAJOMCNP-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |