C9H14N4O — CID 116599888
2-[4-(aminomethyl)triazol-1-yl]-1-cyclobutylethanone (PubChem CID 116599888) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is 2-[4-(aminomethyl)triazol-1-yl]-1-cyclobutylethanone.
| Compound Name | 2-[4-(aminomethyl)triazol-1-yl]-1-cyclobutylethanone |
|---|---|
| PubChem CID | 116599888 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 2-[4-(aminomethyl)triazol-1-yl]-1-cyclobutylethanone |
| SMILES | NCc1cn(CC(=O)C2CCC2)nn1 |
| InChI | InChI=1S/C9H14N4O/c10-4-8-5-13(12-11-8)6-9(14)7-2-1-3-7/h5,7H,1-4,6,10H2 |
| InChIKey | OCKFRZLVFHVLJR-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |