C11H19N5OS — CID 114121457
2-[4-(aminomethyl)triazol-1-yl]-N-(2-methylsulfanylcyclopentyl)acetamide (PubChem CID 114121457) has the molecular formula C11H19N5OS and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-[4-(aminomethyl)triazol-1-yl]-N-(2-methylsulfanylcyclopentyl)acetamide.
| Compound Name | 2-[4-(aminomethyl)triazol-1-yl]-N-(2-methylsulfanylcyclopentyl)acetamide |
|---|---|
| PubChem CID | 114121457 |
| Molecular Formula | C11H19N5OS |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-[4-(aminomethyl)triazol-1-yl]-N-(2-methylsulfanylcyclopentyl)acetamide |
| SMILES | CSC1CCCC1NC(=O)Cn1cc(CN)nn1 |
| InChI | InChI=1S/C11H19N5OS/c1-18-10-4-2-3-9(10)13-11(17)7-16-6-8(5-12)14-15-16/h6,9-10H,2-5,7,12H2,1H3,(H,13,17) |
| InChIKey | JFQJEVUUYWFDON-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |