C13H19N7O — CID 115459210
2-[4-(aminomethyl)triazol-1-yl]-N-(2-imidazol-1-ylcyclopentyl)acetamide (PubChem CID 115459210) has the molecular formula C13H19N7O and a molecular weight of 289.34 g/mol. Its IUPAC name is 2-[4-(aminomethyl)triazol-1-yl]-N-(2-imidazol-1-ylcyclopentyl)acetamide.
| Compound Name | 2-[4-(aminomethyl)triazol-1-yl]-N-(2-imidazol-1-ylcyclopentyl)acetamide |
|---|---|
| PubChem CID | 115459210 |
| Molecular Formula | C13H19N7O |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 2-[4-(aminomethyl)triazol-1-yl]-N-(2-imidazol-1-ylcyclopentyl)acetamide |
| SMILES | NCc1cn(CC(=O)NC2CCCC2n2ccnc2)nn1 |
| InChI | InChI=1S/C13H19N7O/c14-6-10-7-20(18-17-10)8-13(21)16-11-2-1-3-12(11)19-5-4-15-9-19/h4-5,7,9,11-12H,1-3,6,8,14H2,(H,16,21) |
| InChIKey | OBRPXKJXHATLEM-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 103.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |