C11H18N4O — CID 43713522
N-(2-imidazol-1-ylcyclopentyl)-2-(methylamino)acetamide (PubChem CID 43713522) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is N-(2-imidazol-1-ylcyclopentyl)-2-(methylamino)acetamide.
| Compound Name | N-(2-imidazol-1-ylcyclopentyl)-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 43713522 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | N-(2-imidazol-1-ylcyclopentyl)-2-(methylamino)acetamide |
| SMILES | CNCC(=O)NC1CCCC1n1ccnc1 |
| InChI | InChI=1S/C11H18N4O/c1-12-7-11(16)14-9-3-2-4-10(9)15-6-5-13-8-15/h5-6,8-10,12H,2-4,7H2,1H3,(H,14,16) |
| InChIKey | VXMVXISCNPEJSI-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |