C10H16N4O2 — CID 107138462
2-[4-(aminomethyl)triazol-1-yl]-1-(oxan-3-yl)ethanone (PubChem CID 107138462) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-[4-(aminomethyl)triazol-1-yl]-1-(oxan-3-yl)ethanone.
| Compound Name | 2-[4-(aminomethyl)triazol-1-yl]-1-(oxan-3-yl)ethanone |
|---|---|
| PubChem CID | 107138462 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-[4-(aminomethyl)triazol-1-yl]-1-(oxan-3-yl)ethanone |
| SMILES | NCc1cn(CC(=O)C2CCCOC2)nn1 |
| InChI | InChI=1S/C10H16N4O2/c11-4-9-5-14(13-12-9)6-10(15)8-2-1-3-16-7-8/h5,8H,1-4,6-7,11H2 |
| InChIKey | SBZUCWFBFHADNK-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |