C12H20N6O2 — CID 115459404
1-[2-[4-(aminomethyl)triazol-1-yl]acetyl]-6-methylpiperidine-3-carboxamide (PubChem CID 115459404) has the molecular formula C12H20N6O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 1-[2-[4-(aminomethyl)triazol-1-yl]acetyl]-6-methylpiperidine-3-carboxamide.
| Compound Name | 1-[2-[4-(aminomethyl)triazol-1-yl]acetyl]-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 115459404 |
| Molecular Formula | C12H20N6O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1-[2-[4-(aminomethyl)triazol-1-yl]acetyl]-6-methylpiperidine-3-carboxamide |
| SMILES | CC1CCC(C(N)=O)CN1C(=O)Cn1cc(CN)nn1 |
| InChI | InChI=1S/C12H20N6O2/c1-8-2-3-9(12(14)20)5-18(8)11(19)7-17-6-10(4-13)15-16-17/h6,8-9H,2-5,7,13H2,1H3,(H2,14,20) |
| InChIKey | MSIKGTBYZHQTDC-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |