C10H14N6O3 — CID 115460051
4-[2-[4-(aminomethyl)triazol-1-yl]acetyl]-3-methylpiperazine-2,6-dione (PubChem CID 115460051) has the molecular formula C10H14N6O3 and a molecular weight of 266.26 g/mol. Its IUPAC name is 4-[2-[4-(aminomethyl)triazol-1-yl]acetyl]-3-methylpiperazine-2,6-dione.
| Compound Name | 4-[2-[4-(aminomethyl)triazol-1-yl]acetyl]-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 115460051 |
| Molecular Formula | C10H14N6O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 4-[2-[4-(aminomethyl)triazol-1-yl]acetyl]-3-methylpiperazine-2,6-dione |
| SMILES | CC1C(=O)NC(=O)CN1C(=O)Cn1cc(CN)nn1 |
| InChI | InChI=1S/C10H14N6O3/c1-6-10(19)12-8(17)4-16(6)9(18)5-15-3-7(2-11)13-14-15/h3,6H,2,4-5,11H2,1H3,(H,12,17,19) |
| InChIKey | HTWLZXZLUPMCIA-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|