C11H13N5O5 — CID 66288109
1-[2-(2-ethyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]triazole-4-carboxylic acid (PubChem CID 66288109) has the molecular formula C11H13N5O5 and a molecular weight of 295.25 g/mol. Its IUPAC name is 1-[2-(2-ethyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-(2-ethyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66288109 |
| Molecular Formula | C11H13N5O5 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 1-[2-(2-ethyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]triazole-4-carboxylic acid |
| SMILES | CCC1C(=O)NC(=O)CN1C(=O)Cn1cc(C(=O)O)nn1 |
| InChI | InChI=1S/C11H13N5O5/c1-2-7-10(19)12-8(17)4-16(7)9(18)5-15-3-6(11(20)21)13-14-15/h3,7H,2,4-5H2,1H3,(H,20,21)(H,12,17,19) |
| InChIKey | KIRARINDEPPWDA-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 134.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|