C9H12N6O3 — CID 66069080
3-ethyl-4-[2-(tetrazol-1-yl)acetyl]piperazine-2,6-dione (PubChem CID 66069080) has the molecular formula C9H12N6O3 and a molecular weight of 252.23 g/mol. Its IUPAC name is 3-ethyl-4-[2-(tetrazol-1-yl)acetyl]piperazine-2,6-dione.
| Compound Name | 3-ethyl-4-[2-(tetrazol-1-yl)acetyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 66069080 |
| Molecular Formula | C9H12N6O3 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 3-ethyl-4-[2-(tetrazol-1-yl)acetyl]piperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1C(=O)Cn1cnnn1 |
| InChI | InChI=1S/C9H12N6O3/c1-2-6-9(18)11-7(16)3-15(6)8(17)4-14-5-10-12-13-14/h5-6H,2-4H2,1H3,(H,11,16,18) |
| InChIKey | FWDIHNAYRZXXES-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|