C15H13ClN6O3 — CID 87019891
1-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone (PubChem CID 87019891) has the molecular formula C15H13ClN6O3 and a molecular weight of 360.76 g/mol. Its IUPAC name is 1-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone.
| Compound Name | 1-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone |
|---|---|
| PubChem CID | 87019891 |
| Molecular Formula | C15H13ClN6O3 |
| Molecular Weight | 360.76 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 1-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone |
| SMILES | O=C(Cn1cnc([N+](=O)[O-])n1)N1CCc2[nH]c3ccc(Cl)cc3c2C1 |
| InChI | InChI=1S/C15H13ClN6O3/c16-9-1-2-12-10(5-9)11-6-20(4-3-13(11)18-12)14(23)7-21-8-17-15(19-21)22(24)25/h1-2,5,8,18H,3-4,6-7H2 |
| InChIKey | XGCXTRCWMFWIJD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 109.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.76 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|