C21H17ClN4O2 — CID 32692453
6-chloro-3-[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]quinazolin-4-one (PubChem CID 32692453) has the molecular formula C21H17ClN4O2 and a molecular weight of 392.85 g/mol. Its IUPAC name is 6-chloro-3-[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]quinazolin-4-one.
| Compound Name | 6-chloro-3-[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 32692453 |
| Molecular Formula | C21H17ClN4O2 |
| Molecular Weight | 392.85 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 6-chloro-3-[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]quinazolin-4-one |
| SMILES | O=C(Cn1cnc2ccc(Cl)cc2c1=O)N1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C21H17ClN4O2/c22-13-5-6-17-15(9-13)21(28)26(12-23-17)11-20(27)25-8-7-19-16(10-25)14-3-1-2-4-18(14)24-19/h1-6,9,12,24H,7-8,10-11H2 |
| InChIKey | OKTALBVDJPBLQT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.85 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|