C20H21N3O4S — CID 53299026
1-[2-(5,5-dioxophenothiazin-10-yl)acetyl]piperidine-4-carboxamide (PubChem CID 53299026) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is 1-[2-(5,5-dioxophenothiazin-10-yl)acetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(5,5-dioxophenothiazin-10-yl)acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53299026 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 1-[2-(5,5-dioxophenothiazin-10-yl)acetyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)CN2c3ccccc3S(=O)(=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C20H21N3O4S/c21-20(25)14-9-11-22(12-10-14)19(24)13-23-15-5-1-3-7-17(15)28(26,27)18-8-4-2-6-16(18)23/h1-8,14H,9-13H2,(H2,21,25) |
| InChIKey | LEQQTEOLMKUOBQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |