C16H13NO3S — CID 66507618
cyclopropyl-(5,5-dioxophenothiazin-10-yl)methanone (PubChem CID 66507618) has the molecular formula C16H13NO3S and a molecular weight of 299.35 g/mol. Its IUPAC name is cyclopropyl-(5,5-dioxophenothiazin-10-yl)methanone.
| Compound Name | cyclopropyl-(5,5-dioxophenothiazin-10-yl)methanone |
|---|---|
| PubChem CID | 66507618 |
| Molecular Formula | C16H13NO3S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | cyclopropyl-(5,5-dioxophenothiazin-10-yl)methanone |
| SMILES | O=C(C1CC1)N1c2ccccc2S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C16H13NO3S/c18-16(11-9-10-11)17-12-5-1-3-7-14(12)21(19,20)15-8-4-2-6-13(15)17/h1-8,11H,9-10H2 |
| InChIKey | YYQJUAFUAXSIJA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |