C19H21N3O3S — CID 16640166
1-(5,5-dioxophenothiazin-10-yl)-2-piperazin-1-ylpropan-1-one (PubChem CID 16640166) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is 1-(5,5-dioxophenothiazin-10-yl)-2-piperazin-1-ylpropan-1-one.
| Compound Name | 1-(5,5-dioxophenothiazin-10-yl)-2-piperazin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 16640166 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 1-(5,5-dioxophenothiazin-10-yl)-2-piperazin-1-ylpropan-1-one |
| SMILES | CC(C(=O)N1c2ccccc2S(=O)(=O)c2ccccc21)N1CCNCC1 |
| InChI | InChI=1S/C19H21N3O3S/c1-14(21-12-10-20-11-13-21)19(23)22-15-6-2-4-8-17(15)26(24,25)18-9-5-3-7-16(18)22/h2-9,14,20H,10-13H2,1H3 |
| InChIKey | GFLIMFZHWONCTM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |