C20H22N2O3S — CID 46339257
N-cyclohexyl-2-(5,5-dioxophenothiazin-10-yl)acetamide (PubChem CID 46339257) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is N-cyclohexyl-2-(5,5-dioxophenothiazin-10-yl)acetamide.
| Compound Name | N-cyclohexyl-2-(5,5-dioxophenothiazin-10-yl)acetamide |
|---|---|
| PubChem CID | 46339257 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-cyclohexyl-2-(5,5-dioxophenothiazin-10-yl)acetamide |
| SMILES | O=C(CN1c2ccccc2S(=O)(=O)c2ccccc21)NC1CCCCC1 |
| InChI | InChI=1S/C20H22N2O3S/c23-20(21-15-8-2-1-3-9-15)14-22-16-10-4-6-12-18(16)26(24,25)19-13-7-5-11-17(19)22/h4-7,10-13,15H,1-3,8-9,14H2,(H,21,23) |
| InChIKey | GSIDJGNFMRDQKX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |