C14H17N3O3S — CID 22589072
N-cyclopentyl-2-(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)acetamide (PubChem CID 22589072) has the molecular formula C14H17N3O3S and a molecular weight of 307.37 g/mol. Its IUPAC name is N-cyclopentyl-2-(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)acetamide.
| Compound Name | N-cyclopentyl-2-(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)acetamide |
|---|---|
| PubChem CID | 22589072 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-cyclopentyl-2-(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)acetamide |
| SMILES | O=C(CN1C=NS(=O)(=O)c2ccccc21)NC1CCCC1 |
| InChI | InChI=1S/C14H17N3O3S/c18-14(16-11-5-1-2-6-11)9-17-10-15-21(19,20)13-8-4-3-7-12(13)17/h3-4,7-8,10-11H,1-2,5-6,9H2,(H,16,18) |
| InChIKey | OVHACUFDLXUHDU-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |